C26H35BrN2O2 — CID 100577892
(2S)-2-[(4-bromophenyl)methyl-[3-(4-propan-2-ylphenyl)propanoyl]amino]-N-butylpropanamide (PubChem CID 100577892) has the molecular formula C26H35BrN2O2 and a molecular weight of 487.48 g/mol. Its IUPAC name is (2S)-2-[(4-bromophenyl)methyl-[3-(4-propan-2-ylphenyl)propanoyl]amino]-N-butylpropanamide.
| Compound Name | (2S)-2-[(4-bromophenyl)methyl-[3-(4-propan-2-ylphenyl)propanoyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 100577892 |
| Molecular Formula | C26H35BrN2O2 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (2S)-2-[(4-bromophenyl)methyl-[3-(4-propan-2-ylphenyl)propanoyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1ccc(Br)cc1)C(=O)CCc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C26H35BrN2O2/c1-5-6-17-28-26(31)20(4)29(18-22-9-14-24(27)15-10-22)25(30)16-11-21-7-12-23(13-8-21)19(2)3/h7-10,12-15,19-20H,5-6,11,16-18H2,1-4H3,(H,28,31)/t20-/m0/s1 |
| InChIKey | KLTUKWNLNKLDCN-FQEVSTJZSA-N |
| XLogP | 5.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|