C20H26N2O2 — CID 100579055
(3S)-1-phenyl-3-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]pyrrolidine-2,5-dione (PubChem CID 100579055) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is (3S)-1-phenyl-3-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-phenyl-3-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 100579055 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (3S)-1-phenyl-3-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]pyrrolidine-2,5-dione |
| SMILES | CC1(C)C[C@H]2C[C@@](C)(CN2[C@H]2CC(=O)N(c3ccccc3)C2=O)C1 |
| InChI | InChI=1S/C20H26N2O2/c1-19(2)10-15-11-20(3,12-19)13-21(15)16-9-17(23)22(18(16)24)14-7-5-4-6-8-14/h4-8,15-16H,9-13H2,1-3H3/t15-,16-,20+/m0/s1 |
| InChIKey | ILQWATZCJJEDCN-TWOQFEAHSA-N |
| XLogP | 3.22 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|