C11H18O2 — CID 10058170
(2S,6R,8S)-2,8-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene (PubChem CID 10058170) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (2S,6R,8S)-2,8-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene.
| Compound Name | (2S,6R,8S)-2,8-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene |
|---|---|
| PubChem CID | 10058170 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (2S,6R,8S)-2,8-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene |
| SMILES | C[C@H]1CC=C[C@@]2(CCC[C@H](C)O2)O1 |
| InChI | InChI=1S/C11H18O2/c1-9-5-3-7-11(12-9)8-4-6-10(2)13-11/h3,7,9-10H,4-6,8H2,1-2H3/t9-,10-,11+/m0/s1 |
| InChIKey | YYLIKWUEPKLPOE-GARJFASQSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|