C15H24O2 — CID 134858588
2,8-bis[(E)-prop-1-enyl]-1,7-dioxaspiro[5.5]undecane (PubChem CID 134858588) has the molecular formula C15H24O2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 2,8-bis[(E)-prop-1-enyl]-1,7-dioxaspiro[5.5]undecane.
| Compound Name | 2,8-bis[(E)-prop-1-enyl]-1,7-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 134858588 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2,8-bis[(E)-prop-1-enyl]-1,7-dioxaspiro[5.5]undecane |
| SMILES | C/C=C/C1CCCC2(CCCC(/C=C/C)O2)O1 |
| InChI | InChI=1S/C15H24O2/c1-3-7-13-9-5-11-15(16-13)12-6-10-14(17-15)8-4-2/h3-4,7-8,13-14H,5-6,9-12H2,1-2H3/b7-3+,8-4+ |
| InChIKey | HTOLHUOMTBEYEV-FCXRPNKRSA-N |
| XLogP | 3.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|