C15H24O3 — CID 134968346
(8R,10R)-10-ethenyl-5,7,9-trioxadispiro[5.1.58.36]hexadecane (PubChem CID 134968346) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (8R,10R)-10-ethenyl-5,7,9-trioxadispiro[5.1.58.36]hexadecane.
| Compound Name | (8R,10R)-10-ethenyl-5,7,9-trioxadispiro[5.1.58.36]hexadecane |
|---|---|
| PubChem CID | 134968346 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (8R,10R)-10-ethenyl-5,7,9-trioxadispiro[5.1.58.36]hexadecane |
| SMILES | C=C[C@H]1CCC[C@@]2(CCCC3(CCCCO3)O2)O1 |
| InChI | InChI=1S/C15H24O3/c1-2-13-7-5-9-15(17-13)11-6-10-14(18-15)8-3-4-12-16-14/h2,13H,1,3-12H2/t13-,14?,15+/m0/s1 |
| InChIKey | OIDJGGZVCVDAHF-ZHDDOTHNSA-N |
| XLogP | 3.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|