C10H16O2 — CID 134968336
(5S,7R)-7-ethenyl-1,6-dioxaspiro[4.5]decane (PubChem CID 134968336) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (5S,7R)-7-ethenyl-1,6-dioxaspiro[4.5]decane.
| Compound Name | (5S,7R)-7-ethenyl-1,6-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 134968336 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (5S,7R)-7-ethenyl-1,6-dioxaspiro[4.5]decane |
| SMILES | C=C[C@H]1CCC[C@@]2(CCCO2)O1 |
| InChI | InChI=1S/C10H16O2/c1-2-9-5-3-6-10(12-9)7-4-8-11-10/h2,9H,1,3-8H2/t9-,10-/m0/s1 |
| InChIKey | TVZZBBYWCWLGSB-UWVGGRQHSA-N |
| XLogP | 2.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|