C11H18O2 — CID 134986577
(5R,7S)-7-prop-2-enyl-1,6-dioxaspiro[4.5]decane (PubChem CID 134986577) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (5R,7S)-7-prop-2-enyl-1,6-dioxaspiro[4.5]decane.
| Compound Name | (5R,7S)-7-prop-2-enyl-1,6-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 134986577 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (5R,7S)-7-prop-2-enyl-1,6-dioxaspiro[4.5]decane |
| SMILES | C=CC[C@@H]1CCC[C@]2(CCCO2)O1 |
| InChI | InChI=1S/C11H18O2/c1-2-5-10-6-3-7-11(13-10)8-4-9-12-11/h2,10H,1,3-9H2/t10-,11-/m1/s1 |
| InChIKey | VFLKFBLUQPSZQH-GHMZBOCLSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|