C14H24O3 — CID 10657692
2-[3-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]-4-methylideneoxane (PubChem CID 10657692) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 2-[3-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]-4-methylideneoxane.
| Compound Name | 2-[3-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]-4-methylideneoxane |
|---|---|
| PubChem CID | 10657692 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 2-[3-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]-4-methylideneoxane |
| SMILES | C=C1CCOC(CCCC2COC(C)(C)O2)C1 |
| InChI | InChI=1S/C14H24O3/c1-11-7-8-15-12(9-11)5-4-6-13-10-16-14(2,3)17-13/h12-13H,1,4-10H2,2-3H3 |
| InChIKey | KAOIQSIRSNXPIK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|