C16H21N3O4 — CID 100582711
N-[[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]methyl]morpholine-4-carboxamide (PubChem CID 100582711) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is N-[[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]methyl]morpholine-4-carboxamide.
| Compound Name | N-[[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 100582711 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | N-[[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]methyl]morpholine-4-carboxamide |
| SMILES | O=C(NCN1C(=O)[C@@H]2[C@@H](C1=O)[C@H]1C=C[C@H]2CC1)N1CCOCC1 |
| InChI | InChI=1S/C16H21N3O4/c20-14-12-10-1-2-11(4-3-10)13(12)15(21)19(14)9-17-16(22)18-5-7-23-8-6-18/h1-2,10-13H,3-9H2,(H,17,22)/t10-,11-,12-,13-/m0/s1 |
| InChIKey | GGVCWSOUFKNARQ-CYDGBPFRSA-N |
| XLogP | 0.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|