C22H24ClN3OS — CID 100584803
N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-4-[(3,5-dimethylpyrazol-1-yl)methyl]benzamide (PubChem CID 100584803) has the molecular formula C22H24ClN3OS and a molecular weight of 413.97 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-4-[(3,5-dimethylpyrazol-1-yl)methyl]benzamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-4-[(3,5-dimethylpyrazol-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 100584803 |
| Molecular Formula | C22H24ClN3OS |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-4-[(3,5-dimethylpyrazol-1-yl)methyl]benzamide |
| SMILES | Cc1cc(C)n(Cc2ccc(C(=O)NCCSCc3ccc(Cl)cc3)cc2)n1 |
| InChI | InChI=1S/C22H24ClN3OS/c1-16-13-17(2)26(25-16)14-18-3-7-20(8-4-18)22(27)24-11-12-28-15-19-5-9-21(23)10-6-19/h3-10,13H,11-12,14-15H2,1-2H3,(H,24,27) |
| InChIKey | WRPXDRYXUKIAIH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|