C24H29N3O2 — CID 100585299
4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[3-(2-ethoxyphenyl)propyl]benzamide (PubChem CID 100585299) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[3-(2-ethoxyphenyl)propyl]benzamide.
| Compound Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[3-(2-ethoxyphenyl)propyl]benzamide |
|---|---|
| PubChem CID | 100585299 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[3-(2-ethoxyphenyl)propyl]benzamide |
| SMILES | CCOc1ccccc1CCCNC(=O)c1ccc(Cn2nc(C)cc2C)cc1 |
| InChI | InChI=1S/C24H29N3O2/c1-4-29-23-10-6-5-8-21(23)9-7-15-25-24(28)22-13-11-20(12-14-22)17-27-19(3)16-18(2)26-27/h5-6,8,10-14,16H,4,7,9,15,17H2,1-3H3,(H,25,28) |
| InChIKey | XYSCPLIRRZUWRP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|