About N-pent-4-enyl-N-trimethylsilylacetamide
N-pent-4-enyl-N-trimethylsilylacetamide (PubChem CID 10058602) has the molecular formula C10H21NOSi
and a molecular weight of 199.37 g/mol. Its IUPAC name is N-pent-4-enyl-N-trimethylsilylacetamide.
Molecular Properties
| Compound Name | N-pent-4-enyl-N-trimethylsilylacetamide |
| PubChem CID | 10058602 |
| Molecular Formula | C10H21NOSi |
| Molecular Weight | 199.37 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N-pent-4-enyl-N-trimethylsilylacetamide |
| SMILES | C=CCCCN(C(C)=O)[Si](C)(C)C |
| InChI | InChI=1S/C10H21NOSi/c1-6-7-8-9-11(10(2)12)13(3,4)5/h6H,1,7-9H2,2-5H3 |
| InChIKey | OCFBZRDITKWPAT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-pent-4-enyl-N-trimethylsilylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pent-4-enyl-N-trimethylsilylacetamide?
The IUPAC name of N-pent-4-enyl-N-trimethylsilylacetamide (CID 10058602) is N-pent-4-enyl-N-trimethylsilylacetamide.
What is the SMILES notation for N-pent-4-enyl-N-trimethylsilylacetamide?
The canonical SMILES for N-pent-4-enyl-N-trimethylsilylacetamide is C=CCCCN(C(C)=O)[Si](C)(C)C.
What is the InChIKey of N-pent-4-enyl-N-trimethylsilylacetamide?
The InChIKey is OCFBZRDITKWPAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NOSi/c1-6-7-8-9-11(10(2)12)13(3,4)5/h6H,1,7-9H2,2-5H3.
What are the key properties of N-pent-4-enyl-N-trimethylsilylacetamide?
N-pent-4-enyl-N-trimethylsilylacetamide has a molecular weight of 199.37 g/mol, XLogP of 2.64, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-pent-4-enyl-N-trimethylsilylacetamide is sourced from PubChem (CID 10058602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).