C11H21NO2S — CID 155624324
N,N-bis(pent-4-enyl)methanesulfonamide (PubChem CID 155624324) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is N,N-bis(pent-4-enyl)methanesulfonamide.
| Compound Name | N,N-bis(pent-4-enyl)methanesulfonamide |
|---|---|
| PubChem CID | 155624324 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N,N-bis(pent-4-enyl)methanesulfonamide |
| SMILES | C=CCCCN(CCCC=C)S(C)(=O)=O |
| InChI | InChI=1S/C11H21NO2S/c1-4-6-8-10-12(15(3,13)14)11-9-7-5-2/h4-5H,1-2,6-11H2,3H3 |
| InChIKey | QFBHNXSBPUXAGE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|