C11H22N2O3S — CID 113148121
N-butyl-N-methyl-2-[methylsulfonyl(prop-2-enyl)amino]acetamide (PubChem CID 113148121) has the molecular formula C11H22N2O3S and a molecular weight of 262.38 g/mol. Its IUPAC name is N-butyl-N-methyl-2-[methylsulfonyl(prop-2-enyl)amino]acetamide.
| Compound Name | N-butyl-N-methyl-2-[methylsulfonyl(prop-2-enyl)amino]acetamide |
|---|---|
| PubChem CID | 113148121 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N-butyl-N-methyl-2-[methylsulfonyl(prop-2-enyl)amino]acetamide |
| SMILES | C=CCN(CC(=O)N(C)CCCC)S(C)(=O)=O |
| InChI | InChI=1S/C11H22N2O3S/c1-5-7-9-12(3)11(14)10-13(8-6-2)17(4,15)16/h6H,2,5,7-10H2,1,3-4H3 |
| InChIKey | HYNQBVWWKKPHRN-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|