C19H25FN4OS2 — CID 100586770
1-[(2-fluorophenyl)methyl]-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide (PubChem CID 100586770) has the molecular formula C19H25FN4OS2 and a molecular weight of 408.57 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100586770 |
| Molecular Formula | C19H25FN4OS2 |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
| SMILES | CC(C)CSc1nnc(NC(=O)C2CCN(Cc3ccccc3F)CC2)s1 |
| InChI | InChI=1S/C19H25FN4OS2/c1-13(2)12-26-19-23-22-18(27-19)21-17(25)14-7-9-24(10-8-14)11-15-5-3-4-6-16(15)20/h3-6,13-14H,7-12H2,1-2H3,(H,21,22,25) |
| InChIKey | OAZWALQZMQSPOH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|