C18H22Cl2N4OS2 — CID 100729276
1-[(2,6-dichlorophenyl)methyl]-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide (PubChem CID 100729276) has the molecular formula C18H22Cl2N4OS2 and a molecular weight of 445.44 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100729276 |
| Molecular Formula | C18H22Cl2N4OS2 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
| SMILES | CCCSc1nnc(NC(=O)C2CCN(Cc3c(Cl)cccc3Cl)CC2)s1 |
| InChI | InChI=1S/C18H22Cl2N4OS2/c1-2-10-26-18-23-22-17(27-18)21-16(25)12-6-8-24(9-7-12)11-13-14(19)4-3-5-15(13)20/h3-5,12H,2,6-11H2,1H3,(H,21,22,25) |
| InChIKey | WUBBAQWCAZBCON-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|