C32H39N3O4 — CID 100590046
(2S)-2-[3-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(2-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100590046) has the molecular formula C32H39N3O4 and a molecular weight of 529.68 g/mol. Its IUPAC name is (2S)-2-[3-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(2-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[3-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(2-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100590046 |
| Molecular Formula | C32H39N3O4 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | (2S)-2-[3-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(2-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1C)C(=O)CCN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C32H39N3O4/c1-3-4-19-33-30(37)28(21-24-13-6-5-7-14-24)35(22-25-15-9-8-12-23(25)2)29(36)18-20-34-31(38)26-16-10-11-17-27(26)32(34)39/h5-15,26-28H,3-4,16-22H2,1-2H3,(H,33,37)/t26-,27+,28-/m0/s1 |
| InChIKey | PIXQEVHRYQMFEC-IARZGTGTSA-N |
| XLogP | 4.19 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|