C31H35N3O5S — CID 100590534
(2R)-N-butyl-2-[(2-methylphenyl)methyl-[3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoyl]amino]-3-phenylpropanamide (PubChem CID 100590534) has the molecular formula C31H35N3O5S and a molecular weight of 561.70 g/mol. Its IUPAC name is (2R)-N-butyl-2-[(2-methylphenyl)methyl-[3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[(2-methylphenyl)methyl-[3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100590534 |
| Molecular Formula | C31H35N3O5S |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | (2R)-N-butyl-2-[(2-methylphenyl)methyl-[3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccccc1C)C(=O)CCN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C31H35N3O5S/c1-3-4-19-32-30(36)27(21-24-13-6-5-7-14-24)33(22-25-15-9-8-12-23(25)2)29(35)18-20-34-31(37)26-16-10-11-17-28(26)40(34,38)39/h5-17,27H,3-4,18-22H2,1-2H3,(H,32,36)/t27-/m1/s1 |
| InChIKey | BPZFVLWJDCKIAK-HHHXNRCGSA-N |
| XLogP | 4.09 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|