C30H33N3O5S — CID 100595131
(2S)-N-butyl-2-[(3-methylphenyl)methyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-3-phenylpropanamide (PubChem CID 100595131) has the molecular formula C30H33N3O5S and a molecular weight of 547.68 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(3-methylphenyl)methyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(3-methylphenyl)methyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100595131 |
| Molecular Formula | C30H33N3O5S |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | (2S)-N-butyl-2-[(3-methylphenyl)methyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(C)c1)C(=O)CN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C30H33N3O5S/c1-3-4-17-31-29(35)26(19-23-12-6-5-7-13-23)32(20-24-14-10-11-22(2)18-24)28(34)21-33-30(36)25-15-8-9-16-27(25)39(33,37)38/h5-16,18,26H,3-4,17,19-21H2,1-2H3,(H,31,35)/t26-/m0/s1 |
| InChIKey | UTRGGBSHCQQVKL-SANMLTNESA-N |
| XLogP | 3.70 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|