C29H30BrN3O5S — CID 100667961
(2R)-2-[(3-bromophenyl)methyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100667961) has the molecular formula C29H30BrN3O5S and a molecular weight of 612.55 g/mol. Its IUPAC name is (2R)-2-[(3-bromophenyl)methyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[(3-bromophenyl)methyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100667961 |
| Molecular Formula | C29H30BrN3O5S |
| Molecular Weight | 612.55 g/mol |
| Exact Mass | 611.11 |
| IUPAC Name | (2R)-2-[(3-bromophenyl)methyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1cccc(Br)c1)C(=O)CN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C29H30BrN3O5S/c1-2-3-16-31-28(35)25(18-21-10-5-4-6-11-21)32(19-22-12-9-13-23(30)17-22)27(34)20-33-29(36)24-14-7-8-15-26(24)39(33,37)38/h4-15,17,25H,2-3,16,18-20H2,1H3,(H,31,35)/t25-/m1/s1 |
| InChIKey | FEYPUSRGEDSJHI-RUZDIDTESA-N |
| XLogP | 4.15 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|