C23H26BrN3O5S — CID 100576076
(2R)-2-[(4-bromophenyl)methyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-N-butylpropanamide (PubChem CID 100576076) has the molecular formula C23H26BrN3O5S and a molecular weight of 536.45 g/mol. Its IUPAC name is (2R)-2-[(4-bromophenyl)methyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-N-butylpropanamide.
| Compound Name | (2R)-2-[(4-bromophenyl)methyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 100576076 |
| Molecular Formula | C23H26BrN3O5S |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 535.08 |
| IUPAC Name | (2R)-2-[(4-bromophenyl)methyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](C)N(Cc1ccc(Br)cc1)C(=O)CN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C23H26BrN3O5S/c1-3-4-13-25-22(29)16(2)26(14-17-9-11-18(24)12-10-17)21(28)15-27-23(30)19-7-5-6-8-20(19)33(27,31)32/h5-12,16H,3-4,13-15H2,1-2H3,(H,25,29)/t16-/m1/s1 |
| InChIKey | IFNBVKCTUHOAAS-MRXNPFEDSA-N |
| XLogP | 2.93 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|