C24H28BrN3O5S — CID 100571308
(2S)-2-[(3-bromophenyl)methyl-[3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoyl]amino]-N-butylpropanamide (PubChem CID 100571308) has the molecular formula C24H28BrN3O5S and a molecular weight of 550.48 g/mol. Its IUPAC name is (2S)-2-[(3-bromophenyl)methyl-[3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoyl]amino]-N-butylpropanamide.
| Compound Name | (2S)-2-[(3-bromophenyl)methyl-[3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 100571308 |
| Molecular Formula | C24H28BrN3O5S |
| Molecular Weight | 550.48 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | (2S)-2-[(3-bromophenyl)methyl-[3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1cccc(Br)c1)C(=O)CCN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C24H28BrN3O5S/c1-3-4-13-26-23(30)17(2)27(16-18-8-7-9-19(25)15-18)22(29)12-14-28-24(31)20-10-5-6-11-21(20)34(28,32)33/h5-11,15,17H,3-4,12-14,16H2,1-2H3,(H,26,30)/t17-/m0/s1 |
| InChIKey | UCVBYVZURHSNKA-KRWDZBQOSA-N |
| XLogP | 3.32 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|