C24H27Cl2N3O5S — CID 132736227
N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]butanamide (PubChem CID 132736227) has the molecular formula C24H27Cl2N3O5S and a molecular weight of 540.47 g/mol. Its IUPAC name is N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]butanamide.
| Compound Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132736227 |
| Molecular Formula | C24H27Cl2N3O5S |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C24H27Cl2N3O5S/c1-3-5-12-27-23(31)20(4-2)28(14-16-10-11-18(25)19(26)13-16)22(30)15-29-24(32)17-8-6-7-9-21(17)35(29,33)34/h6-11,13,20H,3-5,12,14-15H2,1-2H3,(H,27,31) |
| InChIKey | DLVDKBLQBGAFGL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|