C30H31Cl2N3O5S — CID 100687468
(2S)-N-butyl-2-[(2,4-dichlorophenyl)methyl-[3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoyl]amino]-3-phenylpropanamide (PubChem CID 100687468) has the molecular formula C30H31Cl2N3O5S and a molecular weight of 616.57 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(2,4-dichlorophenyl)methyl-[3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(2,4-dichlorophenyl)methyl-[3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100687468 |
| Molecular Formula | C30H31Cl2N3O5S |
| Molecular Weight | 616.57 g/mol |
| Exact Mass | 615.14 |
| IUPAC Name | (2S)-N-butyl-2-[(2,4-dichlorophenyl)methyl-[3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CCN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C30H31Cl2N3O5S/c1-2-3-16-33-29(37)26(18-21-9-5-4-6-10-21)34(20-22-13-14-23(31)19-25(22)32)28(36)15-17-35-30(38)24-11-7-8-12-27(24)41(35,39)40/h4-14,19,26H,2-3,15-18,20H2,1H3,(H,33,37)/t26-/m0/s1 |
| InChIKey | OZTYUMRXNOHGBJ-SANMLTNESA-N |
| XLogP | 5.08 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|