C12H20O3 — CID 10059036
3-(methoxymethoxy)-4,5,6-trimethylhepta-1,2,5-trien-4-ol (PubChem CID 10059036) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 3-(methoxymethoxy)-4,5,6-trimethylhepta-1,2,5-trien-4-ol.
| Compound Name | 3-(methoxymethoxy)-4,5,6-trimethylhepta-1,2,5-trien-4-ol |
|---|---|
| PubChem CID | 10059036 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 3-(methoxymethoxy)-4,5,6-trimethylhepta-1,2,5-trien-4-ol |
| SMILES | C=C=C(OCOC)C(C)(O)C(C)=C(C)C |
| InChI | InChI=1S/C12H20O3/c1-7-11(15-8-14-6)12(5,13)10(4)9(2)3/h13H,1,8H2,2-6H3 |
| InChIKey | XNTGZNYWIVPQLP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|