C14H26O4Si — CID 10266034
(5Z)-3-(methoxymethoxy)-4,5-dimethyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol (PubChem CID 10266034) has the molecular formula C14H26O4Si and a molecular weight of 286.44 g/mol. Its IUPAC name is (5Z)-3-(methoxymethoxy)-4,5-dimethyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol.
| Compound Name | (5Z)-3-(methoxymethoxy)-4,5-dimethyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol |
|---|---|
| PubChem CID | 10266034 |
| Molecular Formula | C14H26O4Si |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (5Z)-3-(methoxymethoxy)-4,5-dimethyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol |
| SMILES | C=C=C(OCOC)C(C)(O)/C(C)=C(/C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H26O4Si/c1-9-13(17-10-16-5)14(4,15)11(2)12(3)18-19(6,7)8/h15H,1,10H2,2-8H3/b12-11- |
| InChIKey | LTLQOZZDEBPEGU-QXMHVHEDSA-N |
| XLogP | 3.17 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|