C32H41N3O5S — CID 100593855
(2S)-N-butyl-2-[[2-(4-ethoxy-N-methylsulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100593855) has the molecular formula C32H41N3O5S and a molecular weight of 579.76 g/mol. Its IUPAC name is (2S)-N-butyl-2-[[2-(4-ethoxy-N-methylsulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[[2-(4-ethoxy-N-methylsulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100593855 |
| Molecular Formula | C32H41N3O5S |
| Molecular Weight | 579.76 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | (2S)-N-butyl-2-[[2-(4-ethoxy-N-methylsulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(C)c1)C(=O)CN(c1ccc(OCC)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C32H41N3O5S/c1-5-7-20-33-32(37)30(22-26-13-9-8-10-14-26)34(23-27-15-11-12-25(3)21-27)31(36)24-35(41(4,38)39)28-16-18-29(19-17-28)40-6-2/h8-19,21,30H,5-7,20,22-24H2,1-4H3,(H,33,37)/t30-/m0/s1 |
| InChIKey | ZAZXGSMISQZOSU-PMERELPUSA-N |
| XLogP | 4.72 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.76 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|