C37H43N3O5S — CID 133153117
2-[[2-[N-(benzenesulfonyl)-4-ethoxyanilino]acetyl]-[(3-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 133153117) has the molecular formula C37H43N3O5S and a molecular weight of 641.83 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-ethoxyanilino]acetyl]-[(3-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-ethoxyanilino]acetyl]-[(3-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133153117 |
| Molecular Formula | C37H43N3O5S |
| Molecular Weight | 641.83 g/mol |
| Exact Mass | 641.29 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-ethoxyanilino]acetyl]-[(3-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1cccc(C)c1)C(=O)CN(c1ccc(OCC)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C37H43N3O5S/c1-4-6-24-38-37(42)35(26-30-15-9-7-10-16-30)39(27-31-17-13-14-29(3)25-31)36(41)28-40(32-20-22-33(23-21-32)45-5-2)46(43,44)34-18-11-8-12-19-34/h7-23,25,35H,4-6,24,26-28H2,1-3H3,(H,38,42) |
| InChIKey | UWDCALFSTGCEPQ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.83 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|