C40H51N3O4S — CID 100595346
(2R)-2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-[(3-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100595346) has the molecular formula C40H51N3O4S and a molecular weight of 669.93 g/mol. Its IUPAC name is (2R)-2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-[(3-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-[(3-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100595346 |
| Molecular Formula | C40H51N3O4S |
| Molecular Weight | 669.93 g/mol |
| Exact Mass | 669.36 |
| IUPAC Name | (2R)-2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-[(3-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1cccc(C)c1)C(=O)CN(c1ccc(C23CC4CC(CC(C4)C2)C3)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C40H51N3O4S/c1-4-5-18-41-39(45)37(23-30-11-7-6-8-12-30)42(27-31-13-9-10-29(2)19-31)38(44)28-43(48(3,46)47)36-16-14-35(15-17-36)40-24-32-20-33(25-40)22-34(21-32)26-40/h6-17,19,32-34,37H,4-5,18,20-28H2,1-3H3,(H,41,45)/t32?,33?,34?,37-,40?/m1/s1 |
| InChIKey | VAGPPSJOEPCIJY-WSCCUYRRSA-N |
| XLogP | 6.79 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.93 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|