C16H13Cl2N3O3 — CID 100595473
(2S)-4-(2,4-dichlorobenzoyl)-2,3-dihydro-1,4-benzoxazine-2-carbohydrazide (PubChem CID 100595473) has the molecular formula C16H13Cl2N3O3 and a molecular weight of 366.20 g/mol. Its IUPAC name is (2S)-4-(2,4-dichlorobenzoyl)-2,3-dihydro-1,4-benzoxazine-2-carbohydrazide.
| Compound Name | (2S)-4-(2,4-dichlorobenzoyl)-2,3-dihydro-1,4-benzoxazine-2-carbohydrazide |
|---|---|
| PubChem CID | 100595473 |
| Molecular Formula | C16H13Cl2N3O3 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | (2S)-4-(2,4-dichlorobenzoyl)-2,3-dihydro-1,4-benzoxazine-2-carbohydrazide |
| SMILES | NNC(=O)[C@@H]1CN(C(=O)c2ccc(Cl)cc2Cl)c2ccccc2O1 |
| InChI | InChI=1S/C16H13Cl2N3O3/c17-9-5-6-10(11(18)7-9)16(23)21-8-14(15(22)20-19)24-13-4-2-1-3-12(13)21/h1-7,14H,8,19H2,(H,20,22)/t14-/m0/s1 |
| InChIKey | AGABFOUSJAQJMS-AWEZNQCLSA-N |
| XLogP | 2.39 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|