C32H41N3O4S — CID 100596931
N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methylphenyl)methyl]-4-(N-methylsulfonylanilino)butanamide (PubChem CID 100596931) has the molecular formula C32H41N3O4S and a molecular weight of 563.76 g/mol. Its IUPAC name is N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methylphenyl)methyl]-4-(N-methylsulfonylanilino)butanamide.
| Compound Name | N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methylphenyl)methyl]-4-(N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100596931 |
| Molecular Formula | C32H41N3O4S |
| Molecular Weight | 563.76 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methylphenyl)methyl]-4-(N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(C)c1)C(=O)CCCN(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C32H41N3O4S/c1-4-5-21-33-32(37)30(24-27-15-8-6-9-16-27)34(25-28-17-12-14-26(2)23-28)31(36)20-13-22-35(40(3,38)39)29-18-10-7-11-19-29/h6-12,14-19,23,30H,4-5,13,20-22,24-25H2,1-3H3,(H,33,37)/t30-/m0/s1 |
| InChIKey | IBCKGYVQTFCSQO-PMERELPUSA-N |
| XLogP | 5.10 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.76 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|