C33H43N3O4S — CID 133153353
N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-methyl-N-methylsulfonylanilino)-N-[(3-methylphenyl)methyl]butanamide (PubChem CID 133153353) has the molecular formula C33H43N3O4S and a molecular weight of 577.79 g/mol. Its IUPAC name is N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-methyl-N-methylsulfonylanilino)-N-[(3-methylphenyl)methyl]butanamide.
| Compound Name | N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-methyl-N-methylsulfonylanilino)-N-[(3-methylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 133153353 |
| Molecular Formula | C33H43N3O4S |
| Molecular Weight | 577.79 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-methyl-N-methylsulfonylanilino)-N-[(3-methylphenyl)methyl]butanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1cccc(C)c1)C(=O)CCCN(c1ccc(C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C33H43N3O4S/c1-5-6-21-34-33(38)31(24-28-13-8-7-9-14-28)35(25-29-15-10-12-27(3)23-29)32(37)16-11-22-36(41(4,39)40)30-19-17-26(2)18-20-30/h7-10,12-15,17-20,23,31H,5-6,11,16,21-22,24-25H2,1-4H3,(H,34,38) |
| InChIKey | FHSYFFWOEKVPGE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.79 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|