About (2S)-2-amino-N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-N-methylpropanamide
(2S)-2-amino-N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-N-methylpropanamide (PubChem CID 100598355) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is (2S)-2-amino-N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-N-methylpropanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-N-methylpropanamide |
| PubChem CID | 100598355 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | (2S)-2-amino-N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-N-methylpropanamide |
| SMILES | CCC1(CC)[C@H](OC)C[C@H]1N(C)C(=O)[C@H](C)N |
| InChI | InChI=1S/C13H26N2O2/c1-6-13(7-2)10(8-11(13)17-5)15(4)12(16)9(3)14/h9-11H,6-8,14H2,1-5H3/t9-,10+,11+/m0/s1 |
| InChIKey | PTQYFNJOKSJNHQ-HBNTYKKESA-N |
| XLogP | 1.39 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-amino-N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-N-methylpropanamide?
The IUPAC name of (2S)-2-amino-N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-N-methylpropanamide (CID 100598355) is (2S)-2-amino-N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-N-methylpropanamide.
What is the SMILES notation for (2S)-2-amino-N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-N-methylpropanamide?
The canonical SMILES for (2S)-2-amino-N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-N-methylpropanamide is CCC1(CC)[C@H](OC)C[C@H]1N(C)C(=O)[C@H](C)N.
What is the InChIKey of (2S)-2-amino-N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-N-methylpropanamide?
The InChIKey is PTQYFNJOKSJNHQ-HBNTYKKESA-N. The full InChI is InChI=1S/C13H26N2O2/c1-6-13(7-2)10(8-11(13)17-5)15(4)12(16)9(3)14/h9-11H,6-8,14H2,1-5H3/t9-,10+,11+/m0/s1.
What are the key properties of (2S)-2-amino-N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-N-methylpropanamide?
(2S)-2-amino-N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-N-methylpropanamide has a molecular weight of 242.36 g/mol, XLogP of 1.39, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-N-methylpropanamide is sourced from PubChem (CID 100598355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).