C34H39ClF3N3O4S — CID 100599756
N-[(3-chlorophenyl)methyl]-N-[(2S)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanamide (PubChem CID 100599756) has the molecular formula C34H39ClF3N3O4S and a molecular weight of 678.22 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-N-[(2S)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-N-[(2S)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanamide |
|---|---|
| PubChem CID | 100599756 |
| Molecular Formula | C34H39ClF3N3O4S |
| Molecular Weight | 678.22 g/mol |
| Exact Mass | 677.23 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-N-[(2S)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanamide |
| SMILES | CS(=O)(=O)N(CCCC(=O)N(Cc1cccc(Cl)c1)[C@@H](Cc1ccccc1)C(=O)NC1CCCCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C34H39ClF3N3O4S/c1-46(44,45)41(30-18-9-14-27(23-30)34(36,37)38)20-10-19-32(42)40(24-26-13-8-15-28(35)21-26)31(22-25-11-4-2-5-12-25)33(43)39-29-16-6-3-7-17-29/h2,4-5,8-9,11-15,18,21,23,29,31H,3,6-7,10,16-17,19-20,22,24H2,1H3,(H,39,43)/t31-/m0/s1 |
| InChIKey | VGCQTYYVSRSXSA-HKBQPEDESA-N |
| XLogP | 6.99 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.22 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |