C34H42ClN3O5S — CID 133212879
4-(3-chloro-N-methylsulfonylanilino)-N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methoxyphenyl)methyl]butanamide (PubChem CID 133212879) has the molecular formula C34H42ClN3O5S and a molecular weight of 640.25 g/mol. Its IUPAC name is 4-(3-chloro-N-methylsulfonylanilino)-N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methoxyphenyl)methyl]butanamide.
| Compound Name | 4-(3-chloro-N-methylsulfonylanilino)-N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 133212879 |
| Molecular Formula | C34H42ClN3O5S |
| Molecular Weight | 640.25 g/mol |
| Exact Mass | 639.25 |
| IUPAC Name | 4-(3-chloro-N-methylsulfonylanilino)-N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methoxyphenyl)methyl]butanamide |
| SMILES | COc1cccc(CN(C(=O)CCCN(c2cccc(Cl)c2)S(C)(=O)=O)C(Cc2ccccc2)C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C34H42ClN3O5S/c1-43-31-19-9-14-27(22-31)25-37(33(39)20-11-21-38(44(2,41)42)30-18-10-15-28(35)24-30)32(23-26-12-5-3-6-13-26)34(40)36-29-16-7-4-8-17-29/h3,5-6,9-10,12-15,18-19,22,24,29,32H,4,7-8,11,16-17,20-21,23,25H2,1-2H3,(H,36,40) |
| InChIKey | RPWMAXUCYGZIIV-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.25 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |