C35H45N3O6S — CID 133212891
N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-(3-methoxy-N-methylsulfonylanilino)-N-[(3-methoxyphenyl)methyl]butanamide (PubChem CID 133212891) has the molecular formula C35H45N3O6S and a molecular weight of 635.83 g/mol. Its IUPAC name is N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-(3-methoxy-N-methylsulfonylanilino)-N-[(3-methoxyphenyl)methyl]butanamide.
| Compound Name | N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-(3-methoxy-N-methylsulfonylanilino)-N-[(3-methoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 133212891 |
| Molecular Formula | C35H45N3O6S |
| Molecular Weight | 635.83 g/mol |
| Exact Mass | 635.30 |
| IUPAC Name | N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-(3-methoxy-N-methylsulfonylanilino)-N-[(3-methoxyphenyl)methyl]butanamide |
| SMILES | COc1cccc(CN(C(=O)CCCN(c2cccc(OC)c2)S(C)(=O)=O)C(Cc2ccccc2)C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C35H45N3O6S/c1-43-31-19-10-15-28(23-31)26-37(33(24-27-13-6-4-7-14-27)35(40)36-29-16-8-5-9-17-29)34(39)21-12-22-38(45(3,41)42)30-18-11-20-32(25-30)44-2/h4,6-7,10-11,13-15,18-20,23,25,29,33H,5,8-9,12,16-17,21-22,24,26H2,1-3H3,(H,36,40) |
| InChIKey | OHGRCZAEEJTCQF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.83 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |