C16H30O — CID 10060139
(6R,7R)-7-ethenyl-7,11-dimethyldodec-10-en-6-ol (PubChem CID 10060139) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is (6R,7R)-7-ethenyl-7,11-dimethyldodec-10-en-6-ol.
| Compound Name | (6R,7R)-7-ethenyl-7,11-dimethyldodec-10-en-6-ol |
|---|---|
| PubChem CID | 10060139 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | (6R,7R)-7-ethenyl-7,11-dimethyldodec-10-en-6-ol |
| SMILES | C=C[C@@](C)(CCC=C(C)C)[C@H](O)CCCCC |
| InChI | InChI=1S/C16H30O/c1-6-8-9-12-15(17)16(5,7-2)13-10-11-14(3)4/h7,11,15,17H,2,6,8-10,12-13H2,1,3-5H3/t15-,16+/m1/s1 |
| InChIKey | XFWKJTQUXVRSCM-CVEARBPZSA-N |
| XLogP | 4.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|