C21H25Cl2NO2 — CID 100603157
3-(2,6-dichlorophenyl)-N-[3-(3-propan-2-yloxyphenyl)propyl]propanamide (PubChem CID 100603157) has the molecular formula C21H25Cl2NO2 and a molecular weight of 394.34 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N-[3-(3-propan-2-yloxyphenyl)propyl]propanamide.
| Compound Name | 3-(2,6-dichlorophenyl)-N-[3-(3-propan-2-yloxyphenyl)propyl]propanamide |
|---|---|
| PubChem CID | 100603157 |
| Molecular Formula | C21H25Cl2NO2 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N-[3-(3-propan-2-yloxyphenyl)propyl]propanamide |
| SMILES | CC(C)Oc1cccc(CCCNC(=O)CCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C21H25Cl2NO2/c1-15(2)26-17-8-3-6-16(14-17)7-5-13-24-21(25)12-11-18-19(22)9-4-10-20(18)23/h3-4,6,8-10,14-15H,5,7,11-13H2,1-2H3,(H,24,25) |
| InChIKey | YEAUCJKUQUJXDX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|