C21H25Cl3N2O4S — CID 30245426
N-[3-(3-propan-2-yloxyphenyl)propyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide (PubChem CID 30245426) has the molecular formula C21H25Cl3N2O4S and a molecular weight of 507.87 g/mol. Its IUPAC name is N-[3-(3-propan-2-yloxyphenyl)propyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[3-(3-propan-2-yloxyphenyl)propyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30245426 |
| Molecular Formula | C21H25Cl3N2O4S |
| Molecular Weight | 507.87 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | N-[3-(3-propan-2-yloxyphenyl)propyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
| SMILES | CC(C)Oc1cccc(CCCNC(=O)CN(c2cc(Cl)c(Cl)cc2Cl)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H25Cl3N2O4S/c1-14(2)30-16-8-4-6-15(10-16)7-5-9-25-21(27)13-26(31(3,28)29)20-12-18(23)17(22)11-19(20)24/h4,6,8,10-12,14H,5,7,9,13H2,1-3H3,(H,25,27) |
| InChIKey | XLIKEJCCKOWIHU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.87 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|