C19H21Cl3N2O4S — CID 30245383
N-[(3-propan-2-yloxyphenyl)methyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide (PubChem CID 30245383) has the molecular formula C19H21Cl3N2O4S and a molecular weight of 479.81 g/mol. Its IUPAC name is N-[(3-propan-2-yloxyphenyl)methyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(3-propan-2-yloxyphenyl)methyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30245383 |
| Molecular Formula | C19H21Cl3N2O4S |
| Molecular Weight | 479.81 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | N-[(3-propan-2-yloxyphenyl)methyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
| SMILES | CC(C)Oc1cccc(CNC(=O)CN(c2cc(Cl)c(Cl)cc2Cl)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H21Cl3N2O4S/c1-12(2)28-14-6-4-5-13(7-14)10-23-19(25)11-24(29(3,26)27)18-9-16(21)15(20)8-17(18)22/h4-9,12H,10-11H2,1-3H3,(H,23,25) |
| InChIKey | HZLNATKOAVEMOS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.81 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|