C18H19Cl3N2O4S — CID 2229213
N-[2-(4-methoxyphenyl)ethyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide (PubChem CID 2229213) has the molecular formula C18H19Cl3N2O4S and a molecular weight of 465.79 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 2229213 |
| Molecular Formula | C18H19Cl3N2O4S |
| Molecular Weight | 465.79 g/mol |
| Exact Mass | 464.01 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
| SMILES | COc1ccc(CCNC(=O)CN(c2cc(Cl)c(Cl)cc2Cl)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H19Cl3N2O4S/c1-27-13-5-3-12(4-6-13)7-8-22-18(24)11-23(28(2,25)26)17-10-15(20)14(19)9-16(17)21/h3-6,9-10H,7-8,11H2,1-2H3,(H,22,24) |
| InChIKey | IECSYJOUBFSNJO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.79 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|