C14H24O2Si — CID 10060794
trimethyl(spiro[4a,5,6,7,8,8a-hexahydro-4H-naphthalene-3,2'-oxirane]-2-yloxy)silane (PubChem CID 10060794) has the molecular formula C14H24O2Si and a molecular weight of 252.43 g/mol. Its IUPAC name is trimethyl(spiro[4a,5,6,7,8,8a-hexahydro-4H-naphthalene-3,2'-oxirane]-2-yloxy)silane.
| Compound Name | trimethyl(spiro[4a,5,6,7,8,8a-hexahydro-4H-naphthalene-3,2'-oxirane]-2-yloxy)silane |
|---|---|
| PubChem CID | 10060794 |
| Molecular Formula | C14H24O2Si |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | trimethyl(spiro[4a,5,6,7,8,8a-hexahydro-4H-naphthalene-3,2'-oxirane]-2-yloxy)silane |
| SMILES | C[Si](C)(C)OC1=CC2CCCCC2CC12CO2 |
| InChI | InChI=1S/C14H24O2Si/c1-17(2,3)16-13-8-11-6-4-5-7-12(11)9-14(13)10-15-14/h8,11-12H,4-7,9-10H2,1-3H3 |
| InChIKey | FBZWBTQNMYFRDJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|