C17H30O2Si — CID 10447181
tert-butyl-dimethyl-spiro[4a,5,6,7,8,8a-hexahydro-4H-naphthalene-3,2'-oxirane]-2-yloxysilane (PubChem CID 10447181) has the molecular formula C17H30O2Si and a molecular weight of 294.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-spiro[4a,5,6,7,8,8a-hexahydro-4H-naphthalene-3,2'-oxirane]-2-yloxysilane.
| Compound Name | tert-butyl-dimethyl-spiro[4a,5,6,7,8,8a-hexahydro-4H-naphthalene-3,2'-oxirane]-2-yloxysilane |
|---|---|
| PubChem CID | 10447181 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | tert-butyl-dimethyl-spiro[4a,5,6,7,8,8a-hexahydro-4H-naphthalene-3,2'-oxirane]-2-yloxysilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC2CCCCC2CC12CO2 |
| InChI | InChI=1S/C17H30O2Si/c1-16(2,3)20(4,5)19-15-10-13-8-6-7-9-14(13)11-17(15)12-18-17/h10,13-14H,6-9,11-12H2,1-5H3 |
| InChIKey | VBYKWUMMPPTTEV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|