C16H31NO — CID 10060837
3-[(2S,3R,6R)-6-hept-6-enyl-3-methylpiperidin-2-yl]propan-1-ol (PubChem CID 10060837) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is 3-[(2S,3R,6R)-6-hept-6-enyl-3-methylpiperidin-2-yl]propan-1-ol.
| Compound Name | 3-[(2S,3R,6R)-6-hept-6-enyl-3-methylpiperidin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 10060837 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 3-[(2S,3R,6R)-6-hept-6-enyl-3-methylpiperidin-2-yl]propan-1-ol |
| SMILES | C=CCCCCC[C@@H]1CC[C@@H](C)[C@H](CCCO)N1 |
| InChI | InChI=1S/C16H31NO/c1-3-4-5-6-7-9-15-12-11-14(2)16(17-15)10-8-13-18/h3,14-18H,1,4-13H2,2H3/t14-,15-,16+/m1/s1 |
| InChIKey | AEKXRIJJFVXTAD-OAGGEKHMSA-N |
| XLogP | 3.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|