C18H37NO — CID 166691978
(4S)-5,7-dimethyl-11-(methylamino)-6-prop-2-enyldodecan-4-ol (PubChem CID 166691978) has the molecular formula C18H37NO and a molecular weight of 283.50 g/mol. Its IUPAC name is (4S)-5,7-dimethyl-11-(methylamino)-6-prop-2-enyldodecan-4-ol.
| Compound Name | (4S)-5,7-dimethyl-11-(methylamino)-6-prop-2-enyldodecan-4-ol |
|---|---|
| PubChem CID | 166691978 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | (4S)-5,7-dimethyl-11-(methylamino)-6-prop-2-enyldodecan-4-ol |
| SMILES | C=CCC(C(C)CCCC(C)NC)C(C)[C@@H](O)CCC |
| InChI | InChI=1S/C18H37NO/c1-7-10-17(16(5)18(20)11-8-2)14(3)12-9-13-15(4)19-6/h7,14-20H,1,8-13H2,2-6H3/t14?,15?,16?,17?,18-/m0/s1 |
| InChIKey | DWXCUFDYRYLWAE-AFKOEOOISA-N |
| XLogP | 4.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|