C30H35Cl2N3O4S — CID 100609457
(2S)-N-butyl-2-[[2-(3-chloro-4-methyl-N-methylsulfonylanilino)acetyl]-[(2-chlorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100609457) has the molecular formula C30H35Cl2N3O4S and a molecular weight of 604.60 g/mol. Its IUPAC name is (2S)-N-butyl-2-[[2-(3-chloro-4-methyl-N-methylsulfonylanilino)acetyl]-[(2-chlorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[[2-(3-chloro-4-methyl-N-methylsulfonylanilino)acetyl]-[(2-chlorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100609457 |
| Molecular Formula | C30H35Cl2N3O4S |
| Molecular Weight | 604.60 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | (2S)-N-butyl-2-[[2-(3-chloro-4-methyl-N-methylsulfonylanilino)acetyl]-[(2-chlorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)CN(c1ccc(C)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C30H35Cl2N3O4S/c1-4-5-17-33-30(37)28(18-23-11-7-6-8-12-23)34(20-24-13-9-10-14-26(24)31)29(36)21-35(40(3,38)39)25-16-15-22(2)27(32)19-25/h6-16,19,28H,4-5,17-18,20-21H2,1-3H3,(H,33,37)/t28-/m0/s1 |
| InChIKey | JJDQBVTVGQYTMX-NDEPHWFRSA-N |
| XLogP | 5.62 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.60 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|