C20H20N4O2S3 — CID 100610761
N-[4-[(4S,5R)-5-(5-methylthiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide (PubChem CID 100610761) has the molecular formula C20H20N4O2S3 and a molecular weight of 444.61 g/mol. Its IUPAC name is N-[4-[(4S,5R)-5-(5-methylthiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(4S,5R)-5-(5-methylthiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 100610761 |
| Molecular Formula | C20H20N4O2S3 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | N-[4-[(4S,5R)-5-(5-methylthiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide |
| SMILES | Cc1ccc([C@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(NS(C)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C20H20N4O2S3/c1-13-6-11-17(28-13)19-18(16-5-3-4-12-21-16)22-20(27)24(19)15-9-7-14(8-10-15)23-29(2,25)26/h3-12,18-19,23H,1-2H3,(H,22,27)/t18-,19+/m1/s1 |
| InChIKey | HEFPNWJOCFQGPR-MOPGFXCFSA-N |
| XLogP | 4.00 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|