C20H21N5O2S2 — CID 133217243
N-[4-[5-(1-methylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide (PubChem CID 133217243) has the molecular formula C20H21N5O2S2 and a molecular weight of 427.56 g/mol. Its IUPAC name is N-[4-[5-(1-methylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[5-(1-methylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 133217243 |
| Molecular Formula | C20H21N5O2S2 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | N-[4-[5-(1-methylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide |
| SMILES | Cn1ccc(C2C(c3ccccn3)NC(=S)N2c2ccc(NS(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C20H21N5O2S2/c1-24-12-10-14(13-24)19-18(17-5-3-4-11-21-17)22-20(28)25(19)16-8-6-15(7-9-16)23-29(2,26)27/h3-13,18-19,23H,1-2H3,(H,22,28) |
| InChIKey | HLTIRFVVPLOXKB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|