C16H18N2O2S — CID 100612885
N-[(1S,2S)-2-(hydroxymethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 100612885) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is N-[(1S,2S)-2-(hydroxymethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S,2S)-2-(hydroxymethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 100612885 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-[(1S,2S)-2-(hydroxymethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)N[C@@H]1c2ccccc2CC[C@@H]1CO |
| InChI | InChI=1S/C16H18N2O2S/c1-10-15(21-9-17-10)16(20)18-14-12(8-19)7-6-11-4-2-3-5-13(11)14/h2-5,9,12,14,19H,6-8H2,1H3,(H,18,20)/t12-,14+/m1/s1 |
| InChIKey | GGIONSVYYLCIRN-OCCSQVGLSA-N |
| XLogP | 2.48 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |