C28H29BrCl2N2O3 — CID 100613102
(2R)-2-[[2-(4-bromo-2-chlorophenoxy)acetyl]-[(2-chlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100613102) has the molecular formula C28H29BrCl2N2O3 and a molecular weight of 592.36 g/mol. Its IUPAC name is (2R)-2-[[2-(4-bromo-2-chlorophenoxy)acetyl]-[(2-chlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[[2-(4-bromo-2-chlorophenoxy)acetyl]-[(2-chlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100613102 |
| Molecular Formula | C28H29BrCl2N2O3 |
| Molecular Weight | 592.36 g/mol |
| Exact Mass | 590.07 |
| IUPAC Name | (2R)-2-[[2-(4-bromo-2-chlorophenoxy)acetyl]-[(2-chlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)COc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C28H29BrCl2N2O3/c1-2-3-15-32-28(35)25(16-20-9-5-4-6-10-20)33(18-21-11-7-8-12-23(21)30)27(34)19-36-26-14-13-22(29)17-24(26)31/h4-14,17,25H,2-3,15-16,18-19H2,1H3,(H,32,35)/t25-/m1/s1 |
| InChIKey | OVLILMGYLIQPNW-RUZDIDTESA-N |
| XLogP | 6.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.36 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|